About isochromeno[4,3-b]pyridin-6-one
isochromeno[4,3-b]pyridin-6-one (PubChem CID 11229366) has the molecular formula C12H7NO2
and a molecular weight of 197.19 g/mol. Its IUPAC name is isochromeno[4,3-b]pyridin-6-one.
Molecular Properties
| Compound Name | isochromeno[4,3-b]pyridin-6-one |
| PubChem CID | 11229366 |
| Molecular Formula | C12H7NO2 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.05 |
| IUPAC Name | isochromeno[4,3-b]pyridin-6-one |
| SMILES | O=c1oc2cccnc2c2ccccc12 |
| InChI | InChI=1S/C12H7NO2/c14-12-9-5-2-1-4-8(9)11-10(15-12)6-3-7-13-11/h1-7H |
| InChIKey | YYKWDXBOVPPGAN-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze isochromeno[4,3-b]pyridin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of isochromeno[4,3-b]pyridin-6-one?
The IUPAC name of isochromeno[4,3-b]pyridin-6-one (CID 11229366) is isochromeno[4,3-b]pyridin-6-one.
What is the SMILES notation for isochromeno[4,3-b]pyridin-6-one?
The canonical SMILES for isochromeno[4,3-b]pyridin-6-one is O=c1oc2cccnc2c2ccccc12.
What is the InChIKey of isochromeno[4,3-b]pyridin-6-one?
The InChIKey is YYKWDXBOVPPGAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7NO2/c14-12-9-5-2-1-4-8(9)11-10(15-12)6-3-7-13-11/h1-7H.
What are the key properties of isochromeno[4,3-b]pyridin-6-one?
isochromeno[4,3-b]pyridin-6-one has a molecular weight of 197.19 g/mol, XLogP of 2.34, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for isochromeno[4,3-b]pyridin-6-one is sourced from PubChem (CID 11229366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).