About 1-phenylthieno[2,3-d]pyrazole
1-phenylthieno[2,3-d]pyrazole (PubChem CID 11229409) has the molecular formula C11H8N2S
and a molecular weight of 200.27 g/mol. Its IUPAC name is 1-phenylthieno[2,3-d]pyrazole.
Molecular Properties
| Compound Name | 1-phenylthieno[2,3-d]pyrazole |
| PubChem CID | 11229409 |
| Molecular Formula | C11H8N2S |
| Molecular Weight | 200.27 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | 1-phenylthieno[2,3-d]pyrazole |
| SMILES | c1ccc(-n2ncc3sccc32)cc1 |
| InChI | InChI=1S/C11H8N2S/c1-2-4-9(5-3-1)13-10-6-7-14-11(10)8-12-13/h1-8H |
| InChIKey | OKLYDITWBJPURK-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.27 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-phenylthieno[2,3-d]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylthieno[2,3-d]pyrazole?
The IUPAC name of 1-phenylthieno[2,3-d]pyrazole (CID 11229409) is 1-phenylthieno[2,3-d]pyrazole.
What is the SMILES notation for 1-phenylthieno[2,3-d]pyrazole?
The canonical SMILES for 1-phenylthieno[2,3-d]pyrazole is c1ccc(-n2ncc3sccc32)cc1.
What is the InChIKey of 1-phenylthieno[2,3-d]pyrazole?
The InChIKey is OKLYDITWBJPURK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N2S/c1-2-4-9(5-3-1)13-10-6-7-14-11(10)8-12-13/h1-8H.
What are the key properties of 1-phenylthieno[2,3-d]pyrazole?
1-phenylthieno[2,3-d]pyrazole has a molecular weight of 200.27 g/mol, XLogP of 3.09, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylthieno[2,3-d]pyrazole is sourced from PubChem (CID 11229409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).