2-amino-N-hydroxyacetamide;2,2,2-trifluoroacetic acid

C4H7F3N2O4 — CID 11229472

IUPAC2-amino-N-hydroxyacetamide;2,2,2-trifluoroacetic acid
SMILESNCC(=O)NO.O=C(O)C(F)(F)F
InChIInChI=1S/C2HF3O2.C2H6N2O2/c3-2(4,5)1(6)7;3-1-2(5)4-6/h(H,6,7);6H,1,3H2,(H,4,5)
InChIKeyFNVQAXSXPFHQQW-UHFFFAOYSA-N
MW204.10 g/mol
LogP-0.92
Rot. Bonds1

About 2-amino-N-hydroxyacetamide;2,2,2-trifluoroacetic acid

2-amino-N-hydroxyacetamide;2,2,2-trifluoroacetic acid (PubChem CID 11229472) has the molecular formula C4H7F3N2O4 and a molecular weight of 204.10 g/mol. Its IUPAC name is 2-amino-N-hydroxyacetamide;2,2,2-trifluoroacetic acid.

Molecular Properties

Compound Name2-amino-N-hydroxyacetamide;2,2,2-trifluoroacetic acid
PubChem CID11229472
Molecular FormulaC4H7F3N2O4
Molecular Weight204.10 g/mol
Exact Mass204.04
IUPAC Name2-amino-N-hydroxyacetamide;2,2,2-trifluoroacetic acid
SMILESNCC(=O)NO.O=C(O)C(F)(F)F
InChIInChI=1S/C2HF3O2.C2H6N2O2/c3-2(4,5)1(6)7;3-1-2(5)4-6/h(H,6,7);6H,1,3H2,(H,4,5)
InChIKeyFNVQAXSXPFHQQW-UHFFFAOYSA-N
XLogP-0.92
TPSA112.65 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500204.10
LogP ≤ 5-0.92
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 2-amino-N-hydroxyacetamide;2,2,2-trifluoroacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-amino-N-hydroxyacetamide;2,2,2-trifluoroacetic acid?
The IUPAC name of 2-amino-N-hydroxyacetamide;2,2,2-trifluoroacetic acid (CID 11229472) is 2-amino-N-hydroxyacetamide;2,2,2-trifluoroacetic acid.
What is the SMILES notation for 2-amino-N-hydroxyacetamide;2,2,2-trifluoroacetic acid?
The canonical SMILES for 2-amino-N-hydroxyacetamide;2,2,2-trifluoroacetic acid is NCC(=O)NO.O=C(O)C(F)(F)F.
What is the InChIKey of 2-amino-N-hydroxyacetamide;2,2,2-trifluoroacetic acid?
The InChIKey is FNVQAXSXPFHQQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C2HF3O2.C2H6N2O2/c3-2(4,5)1(6)7;3-1-2(5)4-6/h(H,6,7);6H,1,3H2,(H,4,5).
What are the key properties of 2-amino-N-hydroxyacetamide;2,2,2-trifluoroacetic acid?
2-amino-N-hydroxyacetamide;2,2,2-trifluoroacetic acid has a molecular weight of 204.10 g/mol, XLogP of -0.92, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N-hydroxyacetamide;2,2,2-trifluoroacetic acid is sourced from PubChem (CID 11229472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).