C14H17NO — CID 11229651
(4R,4aR,8aR)-4,8,8-trimethyl-5-oxo-4,8a-dihydro-1H-naphthalene-4a-carbonitrile (PubChem CID 11229651) has the molecular formula C14H17NO and a molecular weight of 215.30 g/mol. Its IUPAC name is (4R,4aR,8aR)-4,8,8-trimethyl-5-oxo-4,8a-dihydro-1H-naphthalene-4a-carbonitrile.
| Compound Name | (4R,4aR,8aR)-4,8,8-trimethyl-5-oxo-4,8a-dihydro-1H-naphthalene-4a-carbonitrile |
|---|---|
| PubChem CID | 11229651 |
| Molecular Formula | C14H17NO |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | (4R,4aR,8aR)-4,8,8-trimethyl-5-oxo-4,8a-dihydro-1H-naphthalene-4a-carbonitrile |
| SMILES | C[C@@H]1C=CC[C@@H]2C(C)(C)C=CC(=O)[C@]12C#N |
| InChI | InChI=1S/C14H17NO/c1-10-5-4-6-11-13(2,3)8-7-12(16)14(10,11)9-15/h4-5,7-8,10-11H,6H2,1-3H3/t10-,11-,14-/m1/s1 |
| InChIKey | KMSPGHDFGYOSDI-JTNHKYCSSA-N |
| XLogP | 2.87 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|