About (3S,5R)-3,5-dimethyladamantan-1-amine;hydrochloride
(3S,5R)-3,5-dimethyladamantan-1-amine;hydrochloride (PubChem CID 11229655) has the molecular formula C12H22ClN
and a molecular weight of 215.77 g/mol. Its IUPAC name is (3S,5R)-3,5-dimethyladamantan-1-amine;hydrochloride.
Molecular Properties
| Compound Name | (3S,5R)-3,5-dimethyladamantan-1-amine;hydrochloride |
| PubChem CID | 11229655 |
| Molecular Formula | C12H22ClN |
| Molecular Weight | 215.77 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | (3S,5R)-3,5-dimethyladamantan-1-amine;hydrochloride |
| SMILES | C[C@]12CC3CC(N)(C1)C[C@@](C)(C3)C2.Cl |
| InChI | InChI=1S/C12H21N.ClH/c1-10-3-9-4-11(2,6-10)8-12(13,5-9)7-10;/h9H,3-8,13H2,1-2H3;1H/t9?,10-,11+,12?; |
| InChIKey | LDDHMLJTFXJGPI-LFPUEVJFSA-N |
| XLogP | 3.12 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.77 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3S,5R)-3,5-dimethyladamantan-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,5R)-3,5-dimethyladamantan-1-amine;hydrochloride?
The IUPAC name of (3S,5R)-3,5-dimethyladamantan-1-amine;hydrochloride (CID 11229655) is (3S,5R)-3,5-dimethyladamantan-1-amine;hydrochloride.
What is the SMILES notation for (3S,5R)-3,5-dimethyladamantan-1-amine;hydrochloride?
The canonical SMILES for (3S,5R)-3,5-dimethyladamantan-1-amine;hydrochloride is C[C@]12CC3CC(N)(C1)C[C@@](C)(C3)C2.Cl.
What is the InChIKey of (3S,5R)-3,5-dimethyladamantan-1-amine;hydrochloride?
The InChIKey is LDDHMLJTFXJGPI-LFPUEVJFSA-N. The full InChI is InChI=1S/C12H21N.ClH/c1-10-3-9-4-11(2,6-10)8-12(13,5-9)7-10;/h9H,3-8,13H2,1-2H3;1H/t9?,10-,11+,12?;.
What are the key properties of (3S,5R)-3,5-dimethyladamantan-1-amine;hydrochloride?
(3S,5R)-3,5-dimethyladamantan-1-amine;hydrochloride has a molecular weight of 215.77 g/mol, XLogP of 3.12, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,5R)-3,5-dimethyladamantan-1-amine;hydrochloride is sourced from PubChem (CID 11229655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).