About tert-butyl N-phenacylcarbamate
tert-butyl N-phenacylcarbamate (PubChem CID 11230079) has the molecular formula C13H17NO3
and a molecular weight of 235.28 g/mol. Its IUPAC name is tert-butyl N-phenacylcarbamate.
Molecular Properties
| Compound Name | tert-butyl N-phenacylcarbamate |
| PubChem CID | 11230079 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | tert-butyl N-phenacylcarbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)c1ccccc1 |
| InChI | InChI=1S/C13H17NO3/c1-13(2,3)17-12(16)14-9-11(15)10-7-5-4-6-8-10/h4-8H,9H2,1-3H3,(H,14,16) |
| InChIKey | ODIKTWMCZYPCKQ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl N-phenacylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-phenacylcarbamate?
The IUPAC name of tert-butyl N-phenacylcarbamate (CID 11230079) is tert-butyl N-phenacylcarbamate.
What is the SMILES notation for tert-butyl N-phenacylcarbamate?
The canonical SMILES for tert-butyl N-phenacylcarbamate is CC(C)(C)OC(=O)NCC(=O)c1ccccc1.
What is the InChIKey of tert-butyl N-phenacylcarbamate?
The InChIKey is ODIKTWMCZYPCKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO3/c1-13(2,3)17-12(16)14-9-11(15)10-7-5-4-6-8-10/h4-8H,9H2,1-3H3,(H,14,16).
What are the key properties of tert-butyl N-phenacylcarbamate?
tert-butyl N-phenacylcarbamate has a molecular weight of 235.28 g/mol, XLogP of 2.39, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-phenacylcarbamate is sourced from PubChem (CID 11230079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).