C14H25NO2 — CID 11230182
(2E,6Z)-N-(2-hydroxyethyl)dodeca-2,6-dienamide (PubChem CID 11230182) has the molecular formula C14H25NO2 and a molecular weight of 239.36 g/mol. Its IUPAC name is (2E,6Z)-N-(2-hydroxyethyl)dodeca-2,6-dienamide.
| Compound Name | (2E,6Z)-N-(2-hydroxyethyl)dodeca-2,6-dienamide |
|---|---|
| PubChem CID | 11230182 |
| Molecular Formula | C14H25NO2 |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.19 |
| IUPAC Name | (2E,6Z)-N-(2-hydroxyethyl)dodeca-2,6-dienamide |
| SMILES | CCCCC/C=C\CC/C=C/C(=O)NCCO |
| InChI | InChI=1S/C14H25NO2/c1-2-3-4-5-6-7-8-9-10-11-14(17)15-12-13-16/h6-7,10-11,16H,2-5,8-9,12-13H2,1H3,(H,15,17)/b7-6-,11-10+ |
| InChIKey | JMBJBKXWBZRPAX-JFEAUALZSA-N |
| XLogP | 2.57 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|