About 1-bromo-9H-carbazole
1-bromo-9H-carbazole (PubChem CID 11230335) has the molecular formula C12H8BrN
and a molecular weight of 246.11 g/mol. Its IUPAC name is 1-bromo-9H-carbazole.
Molecular Properties
| Compound Name | 1-bromo-9H-carbazole |
| PubChem CID | 11230335 |
| Molecular Formula | C12H8BrN |
| Molecular Weight | 246.11 g/mol |
| Exact Mass | 244.98 |
| IUPAC Name | 1-bromo-9H-carbazole |
| SMILES | Brc1cccc2c1[nH]c1ccccc12 |
| InChI | InChI=1S/C12H8BrN/c13-10-6-3-5-9-8-4-1-2-7-11(8)14-12(9)10/h1-7,14H |
| InChIKey | VCDOOGZTWDOHEB-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.11 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-bromo-9H-carbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-9H-carbazole?
The IUPAC name of 1-bromo-9H-carbazole (CID 11230335) is 1-bromo-9H-carbazole.
What is the SMILES notation for 1-bromo-9H-carbazole?
The canonical SMILES for 1-bromo-9H-carbazole is Brc1cccc2c1[nH]c1ccccc12.
What is the InChIKey of 1-bromo-9H-carbazole?
The InChIKey is VCDOOGZTWDOHEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8BrN/c13-10-6-3-5-9-8-4-1-2-7-11(8)14-12(9)10/h1-7,14H.
What are the key properties of 1-bromo-9H-carbazole?
1-bromo-9H-carbazole has a molecular weight of 246.11 g/mol, XLogP of 4.08, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-9H-carbazole is sourced from PubChem (CID 11230335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).