C6H5F9 — CID 11230396
1,1,1,2,2,3,3,4,4-nonafluorohexane (PubChem CID 11230396) has the molecular formula C6H5F9 and a molecular weight of 248.09 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,4,4-nonafluorohexane.
| Compound Name | 1,1,1,2,2,3,3,4,4-nonafluorohexane |
|---|---|
| PubChem CID | 11230396 |
| Molecular Formula | C6H5F9 |
| Molecular Weight | 248.09 g/mol |
| Exact Mass | 248.02 |
| IUPAC Name | 1,1,1,2,2,3,3,4,4-nonafluorohexane |
| SMILES | CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H5F9/c1-2-3(7,8)4(9,10)5(11,12)6(13,14)15/h2H2,1H3 |
| InChIKey | RTGGFPLAKRCINA-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.09 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|