C13H16O5 — CID 11230497
ethyl (1R,2S,4S,8R)-1-methoxy-7-oxospiro[bicyclo[2.2.2]oct-5-ene-8,2'-oxirane]-2-carboxylate (PubChem CID 11230497) has the molecular formula C13H16O5 and a molecular weight of 252.27 g/mol. Its IUPAC name is ethyl (1R,2S,4S,8R)-1-methoxy-7-oxospiro[bicyclo[2.2.2]oct-5-ene-8,2'-oxirane]-2-carboxylate.
| Compound Name | ethyl (1R,2S,4S,8R)-1-methoxy-7-oxospiro[bicyclo[2.2.2]oct-5-ene-8,2'-oxirane]-2-carboxylate |
|---|---|
| PubChem CID | 11230497 |
| Molecular Formula | C13H16O5 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | ethyl (1R,2S,4S,8R)-1-methoxy-7-oxospiro[bicyclo[2.2.2]oct-5-ene-8,2'-oxirane]-2-carboxylate |
| SMILES | CCOC(=O)[C@H]1C[C@H]2C=C[C@]1(OC)C(=O)[C@]21CO1 |
| InChI | InChI=1S/C13H16O5/c1-3-17-10(14)9-6-8-4-5-12(9,16-2)11(15)13(8)7-18-13/h4-5,8-9H,3,6-7H2,1-2H3/t8-,9-,12-,13+/m1/s1 |
| InChIKey | SJAYQXYKJMQIKK-RQSQLSILSA-N |
| XLogP | 0.48 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|