About (9-methoxy-3,5-dimethylbenzo[f][1]benzofuran-4-yl)methanol
(9-methoxy-3,5-dimethylbenzo[f][1]benzofuran-4-yl)methanol (PubChem CID 11230604) has the molecular formula C16H16O3
and a molecular weight of 256.30 g/mol. Its IUPAC name is (9-methoxy-3,5-dimethylbenzo[f][1]benzofuran-4-yl)methanol.
Molecular Properties
| Compound Name | (9-methoxy-3,5-dimethylbenzo[f][1]benzofuran-4-yl)methanol |
| PubChem CID | 11230604 |
| Molecular Formula | C16H16O3 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | (9-methoxy-3,5-dimethylbenzo[f][1]benzofuran-4-yl)methanol |
| SMILES | COc1c2cccc(C)c2c(CO)c2c(C)coc12 |
| InChI | InChI=1S/C16H16O3/c1-9-5-4-6-11-13(9)12(7-17)14-10(2)8-19-16(14)15(11)18-3/h4-6,8,17H,7H2,1-3H3 |
| InChIKey | GWCRKJUZYPTASW-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 42.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (9-methoxy-3,5-dimethylbenzo[f][1]benzofuran-4-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (9-methoxy-3,5-dimethylbenzo[f][1]benzofuran-4-yl)methanol?
The IUPAC name of (9-methoxy-3,5-dimethylbenzo[f][1]benzofuran-4-yl)methanol (CID 11230604) is (9-methoxy-3,5-dimethylbenzo[f][1]benzofuran-4-yl)methanol.
What is the SMILES notation for (9-methoxy-3,5-dimethylbenzo[f][1]benzofuran-4-yl)methanol?
The canonical SMILES for (9-methoxy-3,5-dimethylbenzo[f][1]benzofuran-4-yl)methanol is COc1c2cccc(C)c2c(CO)c2c(C)coc12.
What is the InChIKey of (9-methoxy-3,5-dimethylbenzo[f][1]benzofuran-4-yl)methanol?
The InChIKey is GWCRKJUZYPTASW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16O3/c1-9-5-4-6-11-13(9)12(7-17)14-10(2)8-19-16(14)15(11)18-3/h4-6,8,17H,7H2,1-3H3.
What are the key properties of (9-methoxy-3,5-dimethylbenzo[f][1]benzofuran-4-yl)methanol?
(9-methoxy-3,5-dimethylbenzo[f][1]benzofuran-4-yl)methanol has a molecular weight of 256.30 g/mol, XLogP of 3.70, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (9-methoxy-3,5-dimethylbenzo[f][1]benzofuran-4-yl)methanol is sourced from PubChem (CID 11230604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).