C5Cl3F5 — CID 11230761
1,2,3-trichloro-3,4,4,5,5-pentafluorocyclopentene (PubChem CID 11230761) has the molecular formula C5Cl3F5 and a molecular weight of 261.40 g/mol. Its IUPAC name is 1,2,3-trichloro-3,4,4,5,5-pentafluorocyclopentene.
| Compound Name | 1,2,3-trichloro-3,4,4,5,5-pentafluorocyclopentene |
|---|---|
| PubChem CID | 11230761 |
| Molecular Formula | C5Cl3F5 |
| Molecular Weight | 261.40 g/mol |
| Exact Mass | 259.90 |
| IUPAC Name | 1,2,3-trichloro-3,4,4,5,5-pentafluorocyclopentene |
| SMILES | FC1(F)C(Cl)=C(Cl)C(F)(Cl)C1(F)F |
| InChI | InChI=1S/C5Cl3F5/c6-1-2(7)4(10,11)5(12,13)3(1,8)9 |
| InChIKey | JMTPGSMYAMXWBK-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.40 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|