C16H20N4 — CID 11230971
11-methyl-2-piperidin-4-ylidene-4,7,11-triazatricyclo[8.3.0.03,7]trideca-1(10),3,5,12-tetraene (PubChem CID 11230971) has the molecular formula C16H20N4 and a molecular weight of 268.36 g/mol. Its IUPAC name is 11-methyl-2-piperidin-4-ylidene-4,7,11-triazatricyclo[8.3.0.03,7]trideca-1(10),3,5,12-tetraene.
| Compound Name | 11-methyl-2-piperidin-4-ylidene-4,7,11-triazatricyclo[8.3.0.03,7]trideca-1(10),3,5,12-tetraene |
|---|---|
| PubChem CID | 11230971 |
| Molecular Formula | C16H20N4 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | 11-methyl-2-piperidin-4-ylidene-4,7,11-triazatricyclo[8.3.0.03,7]trideca-1(10),3,5,12-tetraene |
| SMILES | Cn1ccc2c1CCn1ccnc1C2=C1CCNCC1 |
| InChI | InChI=1S/C16H20N4/c1-19-9-4-13-14(19)5-10-20-11-8-18-16(20)15(13)12-2-6-17-7-3-12/h4,8-9,11,17H,2-3,5-7,10H2,1H3 |
| InChIKey | SGFIBQBVOOVDSS-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 34.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|