C13H18O6 — CID 11231025
[(2R,3S,6R)-3-acetyloxy-6-(2-oxopropyl)-3,6-dihydro-2H-pyran-2-yl]methyl acetate (PubChem CID 11231025) has the molecular formula C13H18O6 and a molecular weight of 270.28 g/mol. Its IUPAC name is [(2R,3S,6R)-3-acetyloxy-6-(2-oxopropyl)-3,6-dihydro-2H-pyran-2-yl]methyl acetate.
| Compound Name | [(2R,3S,6R)-3-acetyloxy-6-(2-oxopropyl)-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
|---|---|
| PubChem CID | 11231025 |
| Molecular Formula | C13H18O6 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | [(2R,3S,6R)-3-acetyloxy-6-(2-oxopropyl)-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
| SMILES | CC(=O)C[C@@H]1C=C[C@H](OC(C)=O)[C@@H](COC(C)=O)O1 |
| InChI | InChI=1S/C13H18O6/c1-8(14)6-11-4-5-12(18-10(3)16)13(19-11)7-17-9(2)15/h4-5,11-13H,6-7H2,1-3H3/t11-,12-,13+/m0/s1 |
| InChIKey | HFPLFYOZVUTHHI-RWMBFGLXSA-N |
| XLogP | 0.78 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|