About 2-butyl-3,3-dimethyl-2-trimethylsilyloxyhex-5-enal
2-butyl-3,3-dimethyl-2-trimethylsilyloxyhex-5-enal (PubChem CID 11231041) has the molecular formula C15H30O2Si
and a molecular weight of 270.49 g/mol. Its IUPAC name is 2-butyl-3,3-dimethyl-2-trimethylsilyloxyhex-5-enal.
Molecular Properties
| Compound Name | 2-butyl-3,3-dimethyl-2-trimethylsilyloxyhex-5-enal |
| PubChem CID | 11231041 |
| Molecular Formula | C15H30O2Si |
| Molecular Weight | 270.49 g/mol |
| Exact Mass | 270.20 |
| IUPAC Name | 2-butyl-3,3-dimethyl-2-trimethylsilyloxyhex-5-enal |
| SMILES | C=CCC(C)(C)C(C=O)(CCCC)O[Si](C)(C)C |
| InChI | InChI=1S/C15H30O2Si/c1-8-10-12-15(13-16,17-18(5,6)7)14(3,4)11-9-2/h9,13H,2,8,10-12H2,1,3-7H3 |
| InChIKey | JAIWOTRXFLZHTF-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.49 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-butyl-3,3-dimethyl-2-trimethylsilyloxyhex-5-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-3,3-dimethyl-2-trimethylsilyloxyhex-5-enal?
The IUPAC name of 2-butyl-3,3-dimethyl-2-trimethylsilyloxyhex-5-enal (CID 11231041) is 2-butyl-3,3-dimethyl-2-trimethylsilyloxyhex-5-enal.
What is the SMILES notation for 2-butyl-3,3-dimethyl-2-trimethylsilyloxyhex-5-enal?
The canonical SMILES for 2-butyl-3,3-dimethyl-2-trimethylsilyloxyhex-5-enal is C=CCC(C)(C)C(C=O)(CCCC)O[Si](C)(C)C.
What is the InChIKey of 2-butyl-3,3-dimethyl-2-trimethylsilyloxyhex-5-enal?
The InChIKey is JAIWOTRXFLZHTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30O2Si/c1-8-10-12-15(13-16,17-18(5,6)7)14(3,4)11-9-2/h9,13H,2,8,10-12H2,1,3-7H3.
What are the key properties of 2-butyl-3,3-dimethyl-2-trimethylsilyloxyhex-5-enal?
2-butyl-3,3-dimethyl-2-trimethylsilyloxyhex-5-enal has a molecular weight of 270.49 g/mol, XLogP of 4.57, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-3,3-dimethyl-2-trimethylsilyloxyhex-5-enal is sourced from PubChem (CID 11231041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).