C11H13F5O2 — CID 11231086
1-(2-bicyclo[2.2.1]hept-5-enyl)-2,2,4,4,4-pentafluorobutane-1,3-diol (PubChem CID 11231086) has the molecular formula C11H13F5O2 and a molecular weight of 272.21 g/mol. Its IUPAC name is 1-(2-bicyclo[2.2.1]hept-5-enyl)-2,2,4,4,4-pentafluorobutane-1,3-diol.
| Compound Name | 1-(2-bicyclo[2.2.1]hept-5-enyl)-2,2,4,4,4-pentafluorobutane-1,3-diol |
|---|---|
| PubChem CID | 11231086 |
| Molecular Formula | C11H13F5O2 |
| Molecular Weight | 272.21 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 1-(2-bicyclo[2.2.1]hept-5-enyl)-2,2,4,4,4-pentafluorobutane-1,3-diol |
| SMILES | OC(C1CC2C=CC1C2)C(F)(F)C(O)C(F)(F)F |
| InChI | InChI=1S/C11H13F5O2/c12-10(13,9(18)11(14,15)16)8(17)7-4-5-1-2-6(7)3-5/h1-2,5-9,17-18H,3-4H2 |
| InChIKey | PCTLJZFZEQAELO-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.21 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|