About methyl 2-(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)acetate
methyl 2-(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)acetate (PubChem CID 11231222) has the molecular formula C17H24O3
and a molecular weight of 276.38 g/mol. Its IUPAC name is methyl 2-(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)acetate.
Molecular Properties
| Compound Name | methyl 2-(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)acetate |
| PubChem CID | 11231222 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | methyl 2-(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)acetate |
| SMILES | COC(=O)C=C1C=C(C(C)(C)C)C(=O)C(C(C)(C)C)=C1 |
| InChI | InChI=1S/C17H24O3/c1-16(2,3)12-8-11(10-14(18)20-7)9-13(15(12)19)17(4,5)6/h8-10H,1-7H3 |
| InChIKey | BCYNAZQEQJMPBV-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)acetate?
The IUPAC name of methyl 2-(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)acetate (CID 11231222) is methyl 2-(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)acetate.
What is the SMILES notation for methyl 2-(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)acetate?
The canonical SMILES for methyl 2-(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)acetate is COC(=O)C=C1C=C(C(C)(C)C)C(=O)C(C(C)(C)C)=C1.
What is the InChIKey of methyl 2-(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)acetate?
The InChIKey is BCYNAZQEQJMPBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24O3/c1-16(2,3)12-8-11(10-14(18)20-7)9-13(15(12)19)17(4,5)6/h8-10H,1-7H3.
What are the key properties of methyl 2-(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)acetate?
methyl 2-(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)acetate has a molecular weight of 276.38 g/mol, XLogP of 3.61, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)acetate is sourced from PubChem (CID 11231222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).