About 5-methyl-4-phenyl-3-(2,4,6-trimethylphenyl)-1,2-oxazole
5-methyl-4-phenyl-3-(2,4,6-trimethylphenyl)-1,2-oxazole (PubChem CID 11231244) has the molecular formula C19H19NO
and a molecular weight of 277.37 g/mol. Its IUPAC name is 5-methyl-4-phenyl-3-(2,4,6-trimethylphenyl)-1,2-oxazole.
Molecular Properties
| Compound Name | 5-methyl-4-phenyl-3-(2,4,6-trimethylphenyl)-1,2-oxazole |
| PubChem CID | 11231244 |
| Molecular Formula | C19H19NO |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | 5-methyl-4-phenyl-3-(2,4,6-trimethylphenyl)-1,2-oxazole |
| SMILES | Cc1cc(C)c(-c2noc(C)c2-c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C19H19NO/c1-12-10-13(2)17(14(3)11-12)19-18(15(4)21-20-19)16-8-6-5-7-9-16/h5-11H,1-4H3 |
| InChIKey | XEMGPWMXEPSKFU-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-methyl-4-phenyl-3-(2,4,6-trimethylphenyl)-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-4-phenyl-3-(2,4,6-trimethylphenyl)-1,2-oxazole?
The IUPAC name of 5-methyl-4-phenyl-3-(2,4,6-trimethylphenyl)-1,2-oxazole (CID 11231244) is 5-methyl-4-phenyl-3-(2,4,6-trimethylphenyl)-1,2-oxazole.
What is the SMILES notation for 5-methyl-4-phenyl-3-(2,4,6-trimethylphenyl)-1,2-oxazole?
The canonical SMILES for 5-methyl-4-phenyl-3-(2,4,6-trimethylphenyl)-1,2-oxazole is Cc1cc(C)c(-c2noc(C)c2-c2ccccc2)c(C)c1.
What is the InChIKey of 5-methyl-4-phenyl-3-(2,4,6-trimethylphenyl)-1,2-oxazole?
The InChIKey is XEMGPWMXEPSKFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19NO/c1-12-10-13(2)17(14(3)11-12)19-18(15(4)21-20-19)16-8-6-5-7-9-16/h5-11H,1-4H3.
What are the key properties of 5-methyl-4-phenyl-3-(2,4,6-trimethylphenyl)-1,2-oxazole?
5-methyl-4-phenyl-3-(2,4,6-trimethylphenyl)-1,2-oxazole has a molecular weight of 277.37 g/mol, XLogP of 5.24, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-4-phenyl-3-(2,4,6-trimethylphenyl)-1,2-oxazole is sourced from PubChem (CID 11231244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).