About trimethyl-[(Z,3S)-3-methyl-1-phenylsulfanylpent-1-enoxy]silane
trimethyl-[(Z,3S)-3-methyl-1-phenylsulfanylpent-1-enoxy]silane (PubChem CID 11231339) has the molecular formula C15H24OSSi
and a molecular weight of 280.51 g/mol. Its IUPAC name is trimethyl-[(Z,3S)-3-methyl-1-phenylsulfanylpent-1-enoxy]silane.
Molecular Properties
| Compound Name | trimethyl-[(Z,3S)-3-methyl-1-phenylsulfanylpent-1-enoxy]silane |
| PubChem CID | 11231339 |
| Molecular Formula | C15H24OSSi |
| Molecular Weight | 280.51 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | trimethyl-[(Z,3S)-3-methyl-1-phenylsulfanylpent-1-enoxy]silane |
| SMILES | CC[C@H](C)/C=C(/O[Si](C)(C)C)Sc1ccccc1 |
| InChI | InChI=1S/C15H24OSSi/c1-6-13(2)12-15(16-18(3,4)5)17-14-10-8-7-9-11-14/h7-13H,6H2,1-5H3/b15-12-/t13-/m0/s1 |
| InChIKey | MIXNIMJHFFMLIZ-FRRXJZEGSA-N |
| XLogP | 5.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 280.51 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trimethyl-[(Z,3S)-3-methyl-1-phenylsulfanylpent-1-enoxy]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl-[(Z,3S)-3-methyl-1-phenylsulfanylpent-1-enoxy]silane?
The IUPAC name of trimethyl-[(Z,3S)-3-methyl-1-phenylsulfanylpent-1-enoxy]silane (CID 11231339) is trimethyl-[(Z,3S)-3-methyl-1-phenylsulfanylpent-1-enoxy]silane.
What is the SMILES notation for trimethyl-[(Z,3S)-3-methyl-1-phenylsulfanylpent-1-enoxy]silane?
The canonical SMILES for trimethyl-[(Z,3S)-3-methyl-1-phenylsulfanylpent-1-enoxy]silane is CC[C@H](C)/C=C(/O[Si](C)(C)C)Sc1ccccc1.
What is the InChIKey of trimethyl-[(Z,3S)-3-methyl-1-phenylsulfanylpent-1-enoxy]silane?
The InChIKey is MIXNIMJHFFMLIZ-FRRXJZEGSA-N. The full InChI is InChI=1S/C15H24OSSi/c1-6-13(2)12-15(16-18(3,4)5)17-14-10-8-7-9-11-14/h7-13H,6H2,1-5H3/b15-12-/t13-/m0/s1.
What are the key properties of trimethyl-[(Z,3S)-3-methyl-1-phenylsulfanylpent-1-enoxy]silane?
trimethyl-[(Z,3S)-3-methyl-1-phenylsulfanylpent-1-enoxy]silane has a molecular weight of 280.51 g/mol, XLogP of 5.52, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-[(Z,3S)-3-methyl-1-phenylsulfanylpent-1-enoxy]silane is sourced from PubChem (CID 11231339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).