About N-hydroxy-5-[(4-methylphenyl)sulfonylmethyl]-1,2-oxazole-3-carboxamide
N-hydroxy-5-[(4-methylphenyl)sulfonylmethyl]-1,2-oxazole-3-carboxamide (PubChem CID 11231744) has the molecular formula C12H12N2O5S
and a molecular weight of 296.30 g/mol. Its IUPAC name is N-hydroxy-5-[(4-methylphenyl)sulfonylmethyl]-1,2-oxazole-3-carboxamide.
Molecular Properties
| Compound Name | N-hydroxy-5-[(4-methylphenyl)sulfonylmethyl]-1,2-oxazole-3-carboxamide |
| PubChem CID | 11231744 |
| Molecular Formula | C12H12N2O5S |
| Molecular Weight | 296.30 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | N-hydroxy-5-[(4-methylphenyl)sulfonylmethyl]-1,2-oxazole-3-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)Cc2cc(C(=O)NO)no2)cc1 |
| InChI | InChI=1S/C12H12N2O5S/c1-8-2-4-10(5-3-8)20(17,18)7-9-6-11(14-19-9)12(15)13-16/h2-6,16H,7H2,1H3,(H,13,15) |
| InChIKey | COIIIDKYHRRRPA-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 109.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.30 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-hydroxy-5-[(4-methylphenyl)sulfonylmethyl]-1,2-oxazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hydroxy-5-[(4-methylphenyl)sulfonylmethyl]-1,2-oxazole-3-carboxamide?
The IUPAC name of N-hydroxy-5-[(4-methylphenyl)sulfonylmethyl]-1,2-oxazole-3-carboxamide (CID 11231744) is N-hydroxy-5-[(4-methylphenyl)sulfonylmethyl]-1,2-oxazole-3-carboxamide.
What is the SMILES notation for N-hydroxy-5-[(4-methylphenyl)sulfonylmethyl]-1,2-oxazole-3-carboxamide?
The canonical SMILES for N-hydroxy-5-[(4-methylphenyl)sulfonylmethyl]-1,2-oxazole-3-carboxamide is Cc1ccc(S(=O)(=O)Cc2cc(C(=O)NO)no2)cc1.
What is the InChIKey of N-hydroxy-5-[(4-methylphenyl)sulfonylmethyl]-1,2-oxazole-3-carboxamide?
The InChIKey is COIIIDKYHRRRPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O5S/c1-8-2-4-10(5-3-8)20(17,18)7-9-6-11(14-19-9)12(15)13-16/h2-6,16H,7H2,1H3,(H,13,15).
What are the key properties of N-hydroxy-5-[(4-methylphenyl)sulfonylmethyl]-1,2-oxazole-3-carboxamide?
N-hydroxy-5-[(4-methylphenyl)sulfonylmethyl]-1,2-oxazole-3-carboxamide has a molecular weight of 296.30 g/mol, XLogP of 1.08, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-hydroxy-5-[(4-methylphenyl)sulfonylmethyl]-1,2-oxazole-3-carboxamide is sourced from PubChem (CID 11231744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).