C19H24N2O — CID 11231775
(1S,9R,16S,19R)-16-ethyl-2,12-diazapentacyclo[10.6.1.01,9.03,8.016,19]nonadeca-3,5,7-trien-13-one (PubChem CID 11231775) has the molecular formula C19H24N2O and a molecular weight of 296.41 g/mol. Its IUPAC name is (1S,9R,16S,19R)-16-ethyl-2,12-diazapentacyclo[10.6.1.01,9.03,8.016,19]nonadeca-3,5,7-trien-13-one.
| Compound Name | (1S,9R,16S,19R)-16-ethyl-2,12-diazapentacyclo[10.6.1.01,9.03,8.016,19]nonadeca-3,5,7-trien-13-one |
|---|---|
| PubChem CID | 11231775 |
| Molecular Formula | C19H24N2O |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.19 |
| IUPAC Name | (1S,9R,16S,19R)-16-ethyl-2,12-diazapentacyclo[10.6.1.01,9.03,8.016,19]nonadeca-3,5,7-trien-13-one |
| SMILES | CC[C@@]12CCC(=O)N3CC[C@@H]4c5ccccc5N[C@]4(CC1)[C@H]32 |
| InChI | InChI=1S/C19H24N2O/c1-2-18-9-7-16(22)21-12-8-14-13-5-3-4-6-15(13)20-19(14,11-10-18)17(18)21/h3-6,14,17,20H,2,7-12H2,1H3/t14-,17-,18-,19+/m1/s1 |
| InChIKey | YHKHFAWGQVQJOY-AXUOBQJMSA-N |
| XLogP | 3.52 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |