C10H11ClF3NO2Si — CID 11231809
5-chloro-4-(trifluoromethyl)-6-trimethylsilylpyridine-3-carboxylic acid (PubChem CID 11231809) has the molecular formula C10H11ClF3NO2Si and a molecular weight of 297.74 g/mol. Its IUPAC name is 5-chloro-4-(trifluoromethyl)-6-trimethylsilylpyridine-3-carboxylic acid.
| Compound Name | 5-chloro-4-(trifluoromethyl)-6-trimethylsilylpyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 11231809 |
| Molecular Formula | C10H11ClF3NO2Si |
| Molecular Weight | 297.74 g/mol |
| Exact Mass | 297.02 |
| IUPAC Name | 5-chloro-4-(trifluoromethyl)-6-trimethylsilylpyridine-3-carboxylic acid |
| SMILES | C[Si](C)(C)c1ncc(C(=O)O)c(C(F)(F)F)c1Cl |
| InChI | InChI=1S/C10H11ClF3NO2Si/c1-18(2,3)8-7(11)6(10(12,13)14)5(4-15-8)9(16)17/h4H,1-3H3,(H,16,17) |
| InChIKey | UICCAUABBDFYEQ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.74 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|