C13H19ClN4O2 — CID 11231842
5-chloro-6-oxo-1H-pyrimidin-2-olate;2,3,4,6,7,8,9,10-octahydro-1H-pyrimido[1,2-a]azepin-5-ium (PubChem CID 11231842) has the molecular formula C13H19ClN4O2 and a molecular weight of 298.77 g/mol. Its IUPAC name is 5-chloro-6-oxo-1H-pyrimidin-2-olate;2,3,4,6,7,8,9,10-octahydro-1H-pyrimido[1,2-a]azepin-5-ium.
| Compound Name | 5-chloro-6-oxo-1H-pyrimidin-2-olate;2,3,4,6,7,8,9,10-octahydro-1H-pyrimido[1,2-a]azepin-5-ium |
|---|---|
| PubChem CID | 11231842 |
| Molecular Formula | C13H19ClN4O2 |
| Molecular Weight | 298.77 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 5-chloro-6-oxo-1H-pyrimidin-2-olate;2,3,4,6,7,8,9,10-octahydro-1H-pyrimido[1,2-a]azepin-5-ium |
| SMILES | C1CCC2=[N+](CC1)CCCN2.O=c1[nH]c([O-])ncc1Cl |
| InChI | InChI=1S/C9H16N2.C4H3ClN2O2/c1-2-5-9-10-6-4-8-11(9)7-3-1;5-2-1-6-4(9)7-3(2)8/h1-8H2;1H,(H2,6,7,8,9) |
| InChIKey | BMNYUXNXHKRFMS-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 83.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.77 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|