C10H8Br2O — CID 11231966
(1R,8S,9R,10R)-9,10-dibromo-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-triene (PubChem CID 11231966) has the molecular formula C10H8Br2O and a molecular weight of 303.98 g/mol. Its IUPAC name is (1R,8S,9R,10R)-9,10-dibromo-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-triene.
| Compound Name | (1R,8S,9R,10R)-9,10-dibromo-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-triene |
|---|---|
| PubChem CID | 11231966 |
| Molecular Formula | C10H8Br2O |
| Molecular Weight | 303.98 g/mol |
| Exact Mass | 301.89 |
| IUPAC Name | (1R,8S,9R,10R)-9,10-dibromo-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-triene |
| SMILES | Br[C@H]1[C@H](Br)[C@H]2O[C@@H]1c1ccccc12 |
| InChI | InChI=1S/C10H8Br2O/c11-7-8(12)10-6-4-2-1-3-5(6)9(7)13-10/h1-4,7-10H/t7-,8-,9-,10+/m0/s1 |
| InChIKey | ZVMAWERCNZIMCR-AATLWQCWSA-N |
| XLogP | 3.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.98 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|