C14H9ClN2O2S — CID 11231994
12-chloro-14-methyl-15λ6-thia-8,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,8,10,12-heptaene 15,15-dioxide (PubChem CID 11231994) has the molecular formula C14H9ClN2O2S and a molecular weight of 304.76 g/mol. Its IUPAC name is 12-chloro-14-methyl-15λ6-thia-8,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,8,10,12-heptaene 15,15-dioxide.
| Compound Name | 12-chloro-14-methyl-15λ6-thia-8,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,8,10,12-heptaene 15,15-dioxide |
|---|---|
| PubChem CID | 11231994 |
| Molecular Formula | C14H9ClN2O2S |
| Molecular Weight | 304.76 g/mol |
| Exact Mass | 304.01 |
| IUPAC Name | 12-chloro-14-methyl-15λ6-thia-8,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,8,10,12-heptaene 15,15-dioxide |
| SMILES | CN1c2c(Cl)ccc3nc4ccccc4c(c23)S1(=O)=O |
| InChI | InChI=1S/C14H9ClN2O2S/c1-17-13-9(15)6-7-11-12(13)14(20(17,18)19)8-4-2-3-5-10(8)16-11/h2-7H,1H3 |
| InChIKey | XCFJUVMNUPRKCS-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.76 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|