C19H18O2S — CID 11232152
methyl 3-(1,3-diphenylprop-2-ynylsulfanyl)propanoate (PubChem CID 11232152) has the molecular formula C19H18O2S and a molecular weight of 310.42 g/mol. Its IUPAC name is methyl 3-(1,3-diphenylprop-2-ynylsulfanyl)propanoate.
| Compound Name | methyl 3-(1,3-diphenylprop-2-ynylsulfanyl)propanoate |
|---|---|
| PubChem CID | 11232152 |
| Molecular Formula | C19H18O2S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | methyl 3-(1,3-diphenylprop-2-ynylsulfanyl)propanoate |
| SMILES | COC(=O)CCSC(C#Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H18O2S/c1-21-19(20)14-15-22-18(17-10-6-3-7-11-17)13-12-16-8-4-2-5-9-16/h2-11,18H,14-15H2,1H3 |
| InChIKey | KTRXFFQEUPCJJL-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|