C19H24O2Si — CID 11232218
(2S,3R,4S)-1,1-diphenyl-2-propylsilolane-3,4-diol (PubChem CID 11232218) has the molecular formula C19H24O2Si and a molecular weight of 312.49 g/mol. Its IUPAC name is (2S,3R,4S)-1,1-diphenyl-2-propylsilolane-3,4-diol.
| Compound Name | (2S,3R,4S)-1,1-diphenyl-2-propylsilolane-3,4-diol |
|---|---|
| PubChem CID | 11232218 |
| Molecular Formula | C19H24O2Si |
| Molecular Weight | 312.49 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | (2S,3R,4S)-1,1-diphenyl-2-propylsilolane-3,4-diol |
| SMILES | CCC[C@H]1[C@H](O)[C@H](O)C[Si]1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H24O2Si/c1-2-9-18-19(21)17(20)14-22(18,15-10-5-3-6-11-15)16-12-7-4-8-13-16/h3-8,10-13,17-21H,2,9,14H2,1H3/t17-,18+,19-/m1/s1 |
| InChIKey | UTCUOFULKDTTGC-CEXWTWQISA-N |
| XLogP | 2.16 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.49 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|