About 6-(3,4-difluorophenyl)-4-propan-2-yloxypteridin-2-amine
6-(3,4-difluorophenyl)-4-propan-2-yloxypteridin-2-amine (PubChem CID 11232353) has the molecular formula C15H13F2N5O
and a molecular weight of 317.30 g/mol. Its IUPAC name is 6-(3,4-difluorophenyl)-4-propan-2-yloxypteridin-2-amine.
Molecular Properties
| Compound Name | 6-(3,4-difluorophenyl)-4-propan-2-yloxypteridin-2-amine |
| PubChem CID | 11232353 |
| Molecular Formula | C15H13F2N5O |
| Molecular Weight | 317.30 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | 6-(3,4-difluorophenyl)-4-propan-2-yloxypteridin-2-amine |
| SMILES | CC(C)Oc1nc(N)nc2ncc(-c3ccc(F)c(F)c3)nc12 |
| InChI | InChI=1S/C15H13F2N5O/c1-7(2)23-14-12-13(21-15(18)22-14)19-6-11(20-12)8-3-4-9(16)10(17)5-8/h3-7H,1-2H3,(H2,18,19,21,22) |
| InChIKey | XWIQECFOAXDPCF-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 86.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.30 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-(3,4-difluorophenyl)-4-propan-2-yloxypteridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3,4-difluorophenyl)-4-propan-2-yloxypteridin-2-amine?
The IUPAC name of 6-(3,4-difluorophenyl)-4-propan-2-yloxypteridin-2-amine (CID 11232353) is 6-(3,4-difluorophenyl)-4-propan-2-yloxypteridin-2-amine.
What is the SMILES notation for 6-(3,4-difluorophenyl)-4-propan-2-yloxypteridin-2-amine?
The canonical SMILES for 6-(3,4-difluorophenyl)-4-propan-2-yloxypteridin-2-amine is CC(C)Oc1nc(N)nc2ncc(-c3ccc(F)c(F)c3)nc12.
What is the InChIKey of 6-(3,4-difluorophenyl)-4-propan-2-yloxypteridin-2-amine?
The InChIKey is XWIQECFOAXDPCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13F2N5O/c1-7(2)23-14-12-13(21-15(18)22-14)19-6-11(20-12)8-3-4-9(16)10(17)5-8/h3-7H,1-2H3,(H2,18,19,21,22).
What are the key properties of 6-(3,4-difluorophenyl)-4-propan-2-yloxypteridin-2-amine?
6-(3,4-difluorophenyl)-4-propan-2-yloxypteridin-2-amine has a molecular weight of 317.30 g/mol, XLogP of 2.73, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3,4-difluorophenyl)-4-propan-2-yloxypteridin-2-amine is sourced from PubChem (CID 11232353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).