C17H15FN4O2 — CID 11232625
3-[3-(2-ethoxyphenyl)-4-fluorophenyl]-1H-1,2,4-triazole-5-carboxamide (PubChem CID 11232625) has the molecular formula C17H15FN4O2 and a molecular weight of 326.33 g/mol. Its IUPAC name is 3-[3-(2-ethoxyphenyl)-4-fluorophenyl]-1H-1,2,4-triazole-5-carboxamide.
| Compound Name | 3-[3-(2-ethoxyphenyl)-4-fluorophenyl]-1H-1,2,4-triazole-5-carboxamide |
|---|---|
| PubChem CID | 11232625 |
| Molecular Formula | C17H15FN4O2 |
| Molecular Weight | 326.33 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 3-[3-(2-ethoxyphenyl)-4-fluorophenyl]-1H-1,2,4-triazole-5-carboxamide |
| SMILES | CCOc1ccccc1-c1cc(-c2n[nH]c(C(N)=O)n2)ccc1F |
| InChI | InChI=1S/C17H15FN4O2/c1-2-24-14-6-4-3-5-11(14)12-9-10(7-8-13(12)18)16-20-17(15(19)23)22-21-16/h3-9H,2H2,1H3,(H2,19,23)(H,20,21,22) |
| InChIKey | ZQCOOVKGVIXMPO-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.33 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |