C17H30O4Si — CID 11232651
[(1S,2S,5R,7S)-2-[(E)-but-2-enoxy]-6,8-dioxabicyclo[3.2.1]oct-3-en-7-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 11232651) has the molecular formula C17H30O4Si and a molecular weight of 326.51 g/mol. Its IUPAC name is [(1S,2S,5R,7S)-2-[(E)-but-2-enoxy]-6,8-dioxabicyclo[3.2.1]oct-3-en-7-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(1S,2S,5R,7S)-2-[(E)-but-2-enoxy]-6,8-dioxabicyclo[3.2.1]oct-3-en-7-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 11232651 |
| Molecular Formula | C17H30O4Si |
| Molecular Weight | 326.51 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | [(1S,2S,5R,7S)-2-[(E)-but-2-enoxy]-6,8-dioxabicyclo[3.2.1]oct-3-en-7-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | C/C=C/CO[C@H]1C=C[C@H]2O[C@@H]1[C@H](CO[Si](C)(C)C(C)(C)C)O2 |
| InChI | InChI=1S/C17H30O4Si/c1-7-8-11-18-13-9-10-15-20-14(16(13)21-15)12-19-22(5,6)17(2,3)4/h7-10,13-16H,11-12H2,1-6H3/b8-7+/t13-,14-,15+,16-/m0/s1 |
| InChIKey | VVYZEGLECHETCI-BGNJXGLHSA-N |
| XLogP | 3.65 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.51 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|