C18H13N5O2 — CID 11232803
2-(furan-2-yl)-6-(3-phenoxyprop-1-ynyl)-[1,2,4]triazolo[1,5-a]pyrazin-8-amine (PubChem CID 11232803) has the molecular formula C18H13N5O2 and a molecular weight of 331.34 g/mol. Its IUPAC name is 2-(furan-2-yl)-6-(3-phenoxyprop-1-ynyl)-[1,2,4]triazolo[1,5-a]pyrazin-8-amine.
| Compound Name | 2-(furan-2-yl)-6-(3-phenoxyprop-1-ynyl)-[1,2,4]triazolo[1,5-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 11232803 |
| Molecular Formula | C18H13N5O2 |
| Molecular Weight | 331.34 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | 2-(furan-2-yl)-6-(3-phenoxyprop-1-ynyl)-[1,2,4]triazolo[1,5-a]pyrazin-8-amine |
| SMILES | Nc1nc(C#CCOc2ccccc2)cn2nc(-c3ccco3)nc12 |
| InChI | InChI=1S/C18H13N5O2/c19-16-18-21-17(15-9-5-11-25-15)22-23(18)12-13(20-16)6-4-10-24-14-7-2-1-3-8-14/h1-3,5,7-9,11-12H,10H2,(H2,19,20) |
| InChIKey | BDSUXOVMTRRHAO-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 91.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.34 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|