C19H29NO2Si — CID 11232820
N-benzyl-1-[(4R,5R)-5-ethynyl-2,2-dimethyl-1,3-dioxolan-4-yl]-N-(trimethylsilylmethyl)methanamine (PubChem CID 11232820) has the molecular formula C19H29NO2Si and a molecular weight of 331.53 g/mol. Its IUPAC name is N-benzyl-1-[(4R,5R)-5-ethynyl-2,2-dimethyl-1,3-dioxolan-4-yl]-N-(trimethylsilylmethyl)methanamine.
| Compound Name | N-benzyl-1-[(4R,5R)-5-ethynyl-2,2-dimethyl-1,3-dioxolan-4-yl]-N-(trimethylsilylmethyl)methanamine |
|---|---|
| PubChem CID | 11232820 |
| Molecular Formula | C19H29NO2Si |
| Molecular Weight | 331.53 g/mol |
| Exact Mass | 331.20 |
| IUPAC Name | N-benzyl-1-[(4R,5R)-5-ethynyl-2,2-dimethyl-1,3-dioxolan-4-yl]-N-(trimethylsilylmethyl)methanamine |
| SMILES | C#C[C@H]1OC(C)(C)O[C@@H]1CN(Cc1ccccc1)C[Si](C)(C)C |
| InChI | InChI=1S/C19H29NO2Si/c1-7-17-18(22-19(2,3)21-17)14-20(15-23(4,5)6)13-16-11-9-8-10-12-16/h1,8-12,17-18H,13-15H2,2-6H3/t17-,18-/m1/s1 |
| InChIKey | KDOZPLOEADJCMX-QZTJIDSGSA-N |
| XLogP | 3.52 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.53 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|