C20H22N4O — CID 11232913
N-[2-(1H-benzimidazol-4-yloxy)ethyl]-3-(1H-indol-3-yl)propan-1-amine (PubChem CID 11232913) has the molecular formula C20H22N4O and a molecular weight of 334.42 g/mol. Its IUPAC name is N-[2-(1H-benzimidazol-4-yloxy)ethyl]-3-(1H-indol-3-yl)propan-1-amine.
| Compound Name | N-[2-(1H-benzimidazol-4-yloxy)ethyl]-3-(1H-indol-3-yl)propan-1-amine |
|---|---|
| PubChem CID | 11232913 |
| Molecular Formula | C20H22N4O |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | N-[2-(1H-benzimidazol-4-yloxy)ethyl]-3-(1H-indol-3-yl)propan-1-amine |
| SMILES | c1ccc2c(CCCNCCOc3cccc4[nH]cnc34)c[nH]c2c1 |
| InChI | InChI=1S/C20H22N4O/c1-2-7-17-16(6-1)15(13-22-17)5-4-10-21-11-12-25-19-9-3-8-18-20(19)24-14-23-18/h1-3,6-9,13-14,21-22H,4-5,10-12H2,(H,23,24) |
| InChIKey | KDBNOLRCLHHEBP-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 65.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|