About (E)-4-(2,3-dibromo-4,5-dihydroxyphenyl)but-3-en-2-one
(E)-4-(2,3-dibromo-4,5-dihydroxyphenyl)but-3-en-2-one (PubChem CID 11232963) has the molecular formula C10H8Br2O3
and a molecular weight of 335.98 g/mol. Its IUPAC name is (E)-4-(2,3-dibromo-4,5-dihydroxyphenyl)but-3-en-2-one.
Molecular Properties
| Compound Name | (E)-4-(2,3-dibromo-4,5-dihydroxyphenyl)but-3-en-2-one |
| PubChem CID | 11232963 |
| Molecular Formula | C10H8Br2O3 |
| Molecular Weight | 335.98 g/mol |
| Exact Mass | 333.88 |
| IUPAC Name | (E)-4-(2,3-dibromo-4,5-dihydroxyphenyl)but-3-en-2-one |
| SMILES | CC(=O)/C=C/c1cc(O)c(O)c(Br)c1Br |
| InChI | InChI=1S/C10H8Br2O3/c1-5(13)2-3-6-4-7(14)10(15)9(12)8(6)11/h2-4,14-15H,1H3/b3-2+ |
| InChIKey | NHUWNFDDCLZKPA-NSCUHMNNSA-N |
| XLogP | 3.22 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.98 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-4-(2,3-dibromo-4,5-dihydroxyphenyl)but-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-(2,3-dibromo-4,5-dihydroxyphenyl)but-3-en-2-one?
The IUPAC name of (E)-4-(2,3-dibromo-4,5-dihydroxyphenyl)but-3-en-2-one (CID 11232963) is (E)-4-(2,3-dibromo-4,5-dihydroxyphenyl)but-3-en-2-one.
What is the SMILES notation for (E)-4-(2,3-dibromo-4,5-dihydroxyphenyl)but-3-en-2-one?
The canonical SMILES for (E)-4-(2,3-dibromo-4,5-dihydroxyphenyl)but-3-en-2-one is CC(=O)/C=C/c1cc(O)c(O)c(Br)c1Br.
What is the InChIKey of (E)-4-(2,3-dibromo-4,5-dihydroxyphenyl)but-3-en-2-one?
The InChIKey is NHUWNFDDCLZKPA-NSCUHMNNSA-N. The full InChI is InChI=1S/C10H8Br2O3/c1-5(13)2-3-6-4-7(14)10(15)9(12)8(6)11/h2-4,14-15H,1H3/b3-2+.
What are the key properties of (E)-4-(2,3-dibromo-4,5-dihydroxyphenyl)but-3-en-2-one?
(E)-4-(2,3-dibromo-4,5-dihydroxyphenyl)but-3-en-2-one has a molecular weight of 335.98 g/mol, XLogP of 3.22, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-(2,3-dibromo-4,5-dihydroxyphenyl)but-3-en-2-one is sourced from PubChem (CID 11232963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).