C17H28O5Si — CID 11233108
(1R,5S,6R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hydroxy-4-(hydroxymethyl)-6-prop-2-enyl-7-oxabicyclo[4.1.0]hept-3-en-2-one (PubChem CID 11233108) has the molecular formula C17H28O5Si and a molecular weight of 340.49 g/mol. Its IUPAC name is (1R,5S,6R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hydroxy-4-(hydroxymethyl)-6-prop-2-enyl-7-oxabicyclo[4.1.0]hept-3-en-2-one.
| Compound Name | (1R,5S,6R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hydroxy-4-(hydroxymethyl)-6-prop-2-enyl-7-oxabicyclo[4.1.0]hept-3-en-2-one |
|---|---|
| PubChem CID | 11233108 |
| Molecular Formula | C17H28O5Si |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | (1R,5S,6R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hydroxy-4-(hydroxymethyl)-6-prop-2-enyl-7-oxabicyclo[4.1.0]hept-3-en-2-one |
| SMILES | C=CC[C@]12O[C@H]1C(=O)C(CO[Si](C)(C)C(C)(C)C)=C(CO)[C@@H]2O |
| InChI | InChI=1S/C17H28O5Si/c1-7-8-17-14(20)11(9-18)12(13(19)15(17)22-17)10-21-23(5,6)16(2,3)4/h7,14-15,18,20H,1,8-10H2,2-6H3/t14-,15-,17+/m0/s1 |
| InChIKey | UFFUHHGXECHORV-YQQAZPJKSA-N |
| XLogP | 1.95 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|