C15H15F2NO4S — CID 11233198
(1R,2S,3R,5R,6R)-2-amino-6-fluoro-3-[(4-fluorophenyl)methylsulfanyl]bicyclo[3.1.0]hexane-2,6-dicarboxylic acid (PubChem CID 11233198) has the molecular formula C15H15F2NO4S and a molecular weight of 343.35 g/mol. Its IUPAC name is (1R,2S,3R,5R,6R)-2-amino-6-fluoro-3-[(4-fluorophenyl)methylsulfanyl]bicyclo[3.1.0]hexane-2,6-dicarboxylic acid.
| Compound Name | (1R,2S,3R,5R,6R)-2-amino-6-fluoro-3-[(4-fluorophenyl)methylsulfanyl]bicyclo[3.1.0]hexane-2,6-dicarboxylic acid |
|---|---|
| PubChem CID | 11233198 |
| Molecular Formula | C15H15F2NO4S |
| Molecular Weight | 343.35 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | (1R,2S,3R,5R,6R)-2-amino-6-fluoro-3-[(4-fluorophenyl)methylsulfanyl]bicyclo[3.1.0]hexane-2,6-dicarboxylic acid |
| SMILES | N[C@]1(C(=O)O)[C@H]2[C@@H](C[C@H]1SCc1ccc(F)cc1)[C@]2(F)C(=O)O |
| InChI | InChI=1S/C15H15F2NO4S/c16-8-3-1-7(2-4-8)6-23-10-5-9-11(14(9,17)12(19)20)15(10,18)13(21)22/h1-4,9-11H,5-6,18H2,(H,19,20)(H,21,22)/t9-,10-,11+,14-,15+/m1/s1 |
| InChIKey | NMWYHMLTCKIUDD-ZNLHFFCSSA-N |
| XLogP | 1.65 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.35 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |