C17H33N3O4 — CID 11233210
tert-butyl (NE)-N-[[di(propan-2-yl)amino]-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]carbamate (PubChem CID 11233210) has the molecular formula C17H33N3O4 and a molecular weight of 343.47 g/mol. Its IUPAC name is tert-butyl (NE)-N-[[di(propan-2-yl)amino]-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]carbamate.
| Compound Name | tert-butyl (NE)-N-[[di(propan-2-yl)amino]-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]carbamate |
|---|---|
| PubChem CID | 11233210 |
| Molecular Formula | C17H33N3O4 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.25 |
| IUPAC Name | tert-butyl (NE)-N-[[di(propan-2-yl)amino]-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]carbamate |
| SMILES | CC(C)N(/C(=N/C(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)C(C)C |
| InChI | InChI=1S/C17H33N3O4/c1-11(2)20(12(3)4)13(18-14(21)23-16(5,6)7)19-15(22)24-17(8,9)10/h11-12H,1-10H3,(H,18,19,21,22) |
| InChIKey | DURSQFISEZJRGS-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|