C15H17BrN2O3 — CID 11233491
3-[1-[2-(4-bromophenyl)ethyl]-5-oxo-2H-pyrrol-4-yl]-N-hydroxypropanamide (PubChem CID 11233491) has the molecular formula C15H17BrN2O3 and a molecular weight of 353.22 g/mol. Its IUPAC name is 3-[1-[2-(4-bromophenyl)ethyl]-5-oxo-2H-pyrrol-4-yl]-N-hydroxypropanamide.
| Compound Name | 3-[1-[2-(4-bromophenyl)ethyl]-5-oxo-2H-pyrrol-4-yl]-N-hydroxypropanamide |
|---|---|
| PubChem CID | 11233491 |
| Molecular Formula | C15H17BrN2O3 |
| Molecular Weight | 353.22 g/mol |
| Exact Mass | 352.04 |
| IUPAC Name | 3-[1-[2-(4-bromophenyl)ethyl]-5-oxo-2H-pyrrol-4-yl]-N-hydroxypropanamide |
| SMILES | O=C(CCC1=CCN(CCc2ccc(Br)cc2)C1=O)NO |
| InChI | InChI=1S/C15H17BrN2O3/c16-13-4-1-11(2-5-13)7-9-18-10-8-12(15(18)20)3-6-14(19)17-21/h1-2,4-5,8,21H,3,6-7,9-10H2,(H,17,19) |
| InChIKey | WUGVFIHQNRWBLP-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.22 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|