About 3-[(3R,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]-N-phenylpropanamide
3-[(3R,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]-N-phenylpropanamide (PubChem CID 11233617) has the molecular formula C21H25ClN2O
and a molecular weight of 356.90 g/mol. Its IUPAC name is 3-[(3R,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]-N-phenylpropanamide.
Molecular Properties
| Compound Name | 3-[(3R,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]-N-phenylpropanamide |
| PubChem CID | 11233617 |
| Molecular Formula | C21H25ClN2O |
| Molecular Weight | 356.90 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 3-[(3R,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]-N-phenylpropanamide |
| SMILES | CN1CC[C@H](c2ccc(Cl)cc2)[C@@H](CCC(=O)Nc2ccccc2)C1 |
| InChI | InChI=1S/C21H25ClN2O/c1-24-14-13-20(16-7-10-18(22)11-8-16)17(15-24)9-12-21(25)23-19-5-3-2-4-6-19/h2-8,10-11,17,20H,9,12-15H2,1H3,(H,23,25)/t17-,20+/m0/s1 |
| InChIKey | HSRZEKYTEIXXKE-FXAWDEMLSA-N |
| XLogP | 4.79 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.90 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[(3R,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]-N-phenylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3R,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]-N-phenylpropanamide?
The IUPAC name of 3-[(3R,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]-N-phenylpropanamide (CID 11233617) is 3-[(3R,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]-N-phenylpropanamide.
What is the SMILES notation for 3-[(3R,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]-N-phenylpropanamide?
The canonical SMILES for 3-[(3R,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]-N-phenylpropanamide is CN1CC[C@H](c2ccc(Cl)cc2)[C@@H](CCC(=O)Nc2ccccc2)C1.
What is the InChIKey of 3-[(3R,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]-N-phenylpropanamide?
The InChIKey is HSRZEKYTEIXXKE-FXAWDEMLSA-N. The full InChI is InChI=1S/C21H25ClN2O/c1-24-14-13-20(16-7-10-18(22)11-8-16)17(15-24)9-12-21(25)23-19-5-3-2-4-6-19/h2-8,10-11,17,20H,9,12-15H2,1H3,(H,23,25)/t17-,20+/m0/s1.
What are the key properties of 3-[(3R,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]-N-phenylpropanamide?
3-[(3R,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]-N-phenylpropanamide has a molecular weight of 356.90 g/mol, XLogP of 4.79, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3R,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]-N-phenylpropanamide is sourced from PubChem (CID 11233617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).