C22H33NO3 — CID 11233697
(4R)-4-phenyl-3-[(3S,5S,7S)-3,5,7-trimethyldecanoyl]-1,3-oxazolidin-2-one (PubChem CID 11233697) has the molecular formula C22H33NO3 and a molecular weight of 359.51 g/mol. Its IUPAC name is (4R)-4-phenyl-3-[(3S,5S,7S)-3,5,7-trimethyldecanoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-phenyl-3-[(3S,5S,7S)-3,5,7-trimethyldecanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11233697 |
| Molecular Formula | C22H33NO3 |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.25 |
| IUPAC Name | (4R)-4-phenyl-3-[(3S,5S,7S)-3,5,7-trimethyldecanoyl]-1,3-oxazolidin-2-one |
| SMILES | CCC[C@H](C)C[C@H](C)C[C@H](C)CC(=O)N1C(=O)OC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C22H33NO3/c1-5-9-16(2)12-17(3)13-18(4)14-21(24)23-20(15-26-22(23)25)19-10-7-6-8-11-19/h6-8,10-11,16-18,20H,5,9,12-15H2,1-4H3/t16-,17-,18-,20-/m0/s1 |
| InChIKey | QUQNWAVFNQDTPV-JPLJXNOCSA-N |
| XLogP | 5.59 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |