C23H25NO3 — CID 11233824
(13aR)-3,4,6-trimethoxy-9,11,12,13,13a,14-hexahydrophenanthro[9,10-f]indolizine (PubChem CID 11233824) has the molecular formula C23H25NO3 and a molecular weight of 363.46 g/mol. Its IUPAC name is (13aR)-3,4,6-trimethoxy-9,11,12,13,13a,14-hexahydrophenanthro[9,10-f]indolizine.
| Compound Name | (13aR)-3,4,6-trimethoxy-9,11,12,13,13a,14-hexahydrophenanthro[9,10-f]indolizine |
|---|---|
| PubChem CID | 11233824 |
| Molecular Formula | C23H25NO3 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | (13aR)-3,4,6-trimethoxy-9,11,12,13,13a,14-hexahydrophenanthro[9,10-f]indolizine |
| SMILES | COc1ccc2c3c(c4ccc(OC)c(OC)c4c2c1)C[C@H]1CCCN1C3 |
| InChI | InChI=1S/C23H25NO3/c1-25-15-6-7-16-19(12-15)22-17(8-9-21(26-2)23(22)27-3)18-11-14-5-4-10-24(14)13-20(16)18/h6-9,12,14H,4-5,10-11,13H2,1-3H3/t14-/m1/s1 |
| InChIKey | JMYNGCABPFYJBC-CQSZACIVSA-N |
| XLogP | 4.54 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|