C17H25FO2S2Si — CID 11234124
O-ethyl [5-(4-fluorophenyl)-5-oxo-1-trimethylsilylpentan-2-yl]sulfanylmethanethioate (PubChem CID 11234124) has the molecular formula C17H25FO2S2Si and a molecular weight of 372.60 g/mol. Its IUPAC name is O-ethyl [5-(4-fluorophenyl)-5-oxo-1-trimethylsilylpentan-2-yl]sulfanylmethanethioate.
| Compound Name | O-ethyl [5-(4-fluorophenyl)-5-oxo-1-trimethylsilylpentan-2-yl]sulfanylmethanethioate |
|---|---|
| PubChem CID | 11234124 |
| Molecular Formula | C17H25FO2S2Si |
| Molecular Weight | 372.60 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | O-ethyl [5-(4-fluorophenyl)-5-oxo-1-trimethylsilylpentan-2-yl]sulfanylmethanethioate |
| SMILES | CCOC(=S)SC(CCC(=O)c1ccc(F)cc1)C[Si](C)(C)C |
| InChI | InChI=1S/C17H25FO2S2Si/c1-5-20-17(21)22-15(12-23(2,3)4)10-11-16(19)13-6-8-14(18)9-7-13/h6-9,15H,5,10-12H2,1-4H3 |
| InChIKey | XHXMWXASHYHHPW-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.60 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|