C18H20N8O2 — CID 11234349
2-(furan-2-yl)-5-N-[[(2R)-1-(furan-2-ylmethyl)pyrrolidin-2-yl]methyl]-[1,2,4]triazolo[1,5-a][1,3,5]triazine-5,7-diamine (PubChem CID 11234349) has the molecular formula C18H20N8O2 and a molecular weight of 380.41 g/mol. Its IUPAC name is 2-(furan-2-yl)-5-N-[[(2R)-1-(furan-2-ylmethyl)pyrrolidin-2-yl]methyl]-[1,2,4]triazolo[1,5-a][1,3,5]triazine-5,7-diamine.
| Compound Name | 2-(furan-2-yl)-5-N-[[(2R)-1-(furan-2-ylmethyl)pyrrolidin-2-yl]methyl]-[1,2,4]triazolo[1,5-a][1,3,5]triazine-5,7-diamine |
|---|---|
| PubChem CID | 11234349 |
| Molecular Formula | C18H20N8O2 |
| Molecular Weight | 380.41 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 2-(furan-2-yl)-5-N-[[(2R)-1-(furan-2-ylmethyl)pyrrolidin-2-yl]methyl]-[1,2,4]triazolo[1,5-a][1,3,5]triazine-5,7-diamine |
| SMILES | Nc1nc(NC[C@H]2CCCN2Cc2ccco2)nc2nc(-c3ccco3)nn12 |
| InChI | InChI=1S/C18H20N8O2/c19-16-22-17(23-18-21-15(24-26(16)18)14-6-3-9-28-14)20-10-12-4-1-7-25(12)11-13-5-2-8-27-13/h2-3,5-6,8-9,12H,1,4,7,10-11H2,(H3,19,20,21,22,23,24)/t12-/m1/s1 |
| InChIKey | WOAGBHKYPSUWSN-GFCCVEGCSA-N |
| XLogP | 2.03 |
| TPSA | 123.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.41 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |