About 5,6-diphenyl-7-thiophen-2-ylpyrido[2,3-d]pyrimidin-4-amine
5,6-diphenyl-7-thiophen-2-ylpyrido[2,3-d]pyrimidin-4-amine (PubChem CID 11234357) has the molecular formula C23H16N4S
and a molecular weight of 380.48 g/mol. Its IUPAC name is 5,6-diphenyl-7-thiophen-2-ylpyrido[2,3-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 5,6-diphenyl-7-thiophen-2-ylpyrido[2,3-d]pyrimidin-4-amine |
| PubChem CID | 11234357 |
| Molecular Formula | C23H16N4S |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | 5,6-diphenyl-7-thiophen-2-ylpyrido[2,3-d]pyrimidin-4-amine |
| SMILES | Nc1ncnc2nc(-c3cccs3)c(-c3ccccc3)c(-c3ccccc3)c12 |
| InChI | InChI=1S/C23H16N4S/c24-22-20-18(15-8-3-1-4-9-15)19(16-10-5-2-6-11-16)21(17-12-7-13-28-17)27-23(20)26-14-25-22/h1-14H,(H2,24,25,26,27) |
| InChIKey | LLOYWJOZQUIAAS-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5,6-diphenyl-7-thiophen-2-ylpyrido[2,3-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-diphenyl-7-thiophen-2-ylpyrido[2,3-d]pyrimidin-4-amine?
The IUPAC name of 5,6-diphenyl-7-thiophen-2-ylpyrido[2,3-d]pyrimidin-4-amine (CID 11234357) is 5,6-diphenyl-7-thiophen-2-ylpyrido[2,3-d]pyrimidin-4-amine.
What is the SMILES notation for 5,6-diphenyl-7-thiophen-2-ylpyrido[2,3-d]pyrimidin-4-amine?
The canonical SMILES for 5,6-diphenyl-7-thiophen-2-ylpyrido[2,3-d]pyrimidin-4-amine is Nc1ncnc2nc(-c3cccs3)c(-c3ccccc3)c(-c3ccccc3)c12.
What is the InChIKey of 5,6-diphenyl-7-thiophen-2-ylpyrido[2,3-d]pyrimidin-4-amine?
The InChIKey is LLOYWJOZQUIAAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H16N4S/c24-22-20-18(15-8-3-1-4-9-15)19(16-10-5-2-6-11-16)21(17-12-7-13-28-17)27-23(20)26-14-25-22/h1-14H,(H2,24,25,26,27).
What are the key properties of 5,6-diphenyl-7-thiophen-2-ylpyrido[2,3-d]pyrimidin-4-amine?
5,6-diphenyl-7-thiophen-2-ylpyrido[2,3-d]pyrimidin-4-amine has a molecular weight of 380.48 g/mol, XLogP of 5.67, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-diphenyl-7-thiophen-2-ylpyrido[2,3-d]pyrimidin-4-amine is sourced from PubChem (CID 11234357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).