C21H22N2O5 — CID 11234411
dimethyl (4S,5R)-1,3-dibenzyl-2-oxoimidazolidine-4,5-dicarboxylate (PubChem CID 11234411) has the molecular formula C21H22N2O5 and a molecular weight of 382.42 g/mol. Its IUPAC name is dimethyl (4S,5R)-1,3-dibenzyl-2-oxoimidazolidine-4,5-dicarboxylate.
| Compound Name | dimethyl (4S,5R)-1,3-dibenzyl-2-oxoimidazolidine-4,5-dicarboxylate |
|---|---|
| PubChem CID | 11234411 |
| Molecular Formula | C21H22N2O5 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | dimethyl (4S,5R)-1,3-dibenzyl-2-oxoimidazolidine-4,5-dicarboxylate |
| SMILES | COC(=O)[C@@H]1[C@H](C(=O)OC)N(Cc2ccccc2)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C21H22N2O5/c1-27-19(24)17-18(20(25)28-2)23(14-16-11-7-4-8-12-16)21(26)22(17)13-15-9-5-3-6-10-15/h3-12,17-18H,13-14H2,1-2H3/t17-,18+ |
| InChIKey | BBTUUSONTSSVJB-HDICACEKSA-N |
| XLogP | 2.21 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |