C18H24F3N3O3 — CID 11234584
1,1,3-trimethyl-3-[3-[[7-propyl-3-(trifluoromethyl)-1,2-benzoxazol-6-yl]oxy]propyl]urea (PubChem CID 11234584) has the molecular formula C18H24F3N3O3 and a molecular weight of 387.40 g/mol. Its IUPAC name is 1,1,3-trimethyl-3-[3-[[7-propyl-3-(trifluoromethyl)-1,2-benzoxazol-6-yl]oxy]propyl]urea.
| Compound Name | 1,1,3-trimethyl-3-[3-[[7-propyl-3-(trifluoromethyl)-1,2-benzoxazol-6-yl]oxy]propyl]urea |
|---|---|
| PubChem CID | 11234584 |
| Molecular Formula | C18H24F3N3O3 |
| Molecular Weight | 387.40 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | 1,1,3-trimethyl-3-[3-[[7-propyl-3-(trifluoromethyl)-1,2-benzoxazol-6-yl]oxy]propyl]urea |
| SMILES | CCCc1c(OCCCN(C)C(=O)N(C)C)ccc2c(C(F)(F)F)noc12 |
| InChI | InChI=1S/C18H24F3N3O3/c1-5-7-12-14(26-11-6-10-24(4)17(25)23(2)3)9-8-13-15(12)27-22-16(13)18(19,20)21/h8-9H,5-7,10-11H2,1-4H3 |
| InChIKey | ZNMWVMOIRXTHTM-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 58.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.40 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|