C23H23NO5 — CID 11234771
ethyl (1R,2S,9aS)-4,9-dioxo-1,2-diphenyl-2,5,7,8-tetrahydro-1H-pyrrolo[1,2-d][1,4]oxazepine-9a-carboxylate (PubChem CID 11234771) has the molecular formula C23H23NO5 and a molecular weight of 393.44 g/mol. Its IUPAC name is ethyl (1R,2S,9aS)-4,9-dioxo-1,2-diphenyl-2,5,7,8-tetrahydro-1H-pyrrolo[1,2-d][1,4]oxazepine-9a-carboxylate.
| Compound Name | ethyl (1R,2S,9aS)-4,9-dioxo-1,2-diphenyl-2,5,7,8-tetrahydro-1H-pyrrolo[1,2-d][1,4]oxazepine-9a-carboxylate |
|---|---|
| PubChem CID | 11234771 |
| Molecular Formula | C23H23NO5 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | ethyl (1R,2S,9aS)-4,9-dioxo-1,2-diphenyl-2,5,7,8-tetrahydro-1H-pyrrolo[1,2-d][1,4]oxazepine-9a-carboxylate |
| SMILES | CCOC(=O)[C@]12C(=O)CCN1CC(=O)O[C@H](c1ccccc1)[C@@H]2c1ccccc1 |
| InChI | InChI=1S/C23H23NO5/c1-2-28-22(27)23-18(25)13-14-24(23)15-19(26)29-21(17-11-7-4-8-12-17)20(23)16-9-5-3-6-10-16/h3-12,20-21H,2,13-15H2,1H3/t20-,21+,23+/m0/s1 |
| InChIKey | CPMUXOKBBBIDGU-QZNHQXDQSA-N |
| XLogP | 2.64 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|