C21H30F2N2O3 — CID 11234872
(E)-N-[(5S,6S)-6-acetamido-7-(3,5-difluorophenyl)-5-hydroxyheptan-3-yl]hex-3-enamide (PubChem CID 11234872) has the molecular formula C21H30F2N2O3 and a molecular weight of 396.48 g/mol. Its IUPAC name is (E)-N-[(5S,6S)-6-acetamido-7-(3,5-difluorophenyl)-5-hydroxyheptan-3-yl]hex-3-enamide.
| Compound Name | (E)-N-[(5S,6S)-6-acetamido-7-(3,5-difluorophenyl)-5-hydroxyheptan-3-yl]hex-3-enamide |
|---|---|
| PubChem CID | 11234872 |
| Molecular Formula | C21H30F2N2O3 |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | (E)-N-[(5S,6S)-6-acetamido-7-(3,5-difluorophenyl)-5-hydroxyheptan-3-yl]hex-3-enamide |
| SMILES | CC/C=C/CC(=O)NC(CC)C[C@H](O)[C@H](Cc1cc(F)cc(F)c1)NC(C)=O |
| InChI | InChI=1S/C21H30F2N2O3/c1-4-6-7-8-21(28)25-18(5-2)13-20(27)19(24-14(3)26)11-15-9-16(22)12-17(23)10-15/h6-7,9-10,12,18-20,27H,4-5,8,11,13H2,1-3H3,(H,24,26)(H,25,28)/b7-6+/t18?,19-,20-/m0/s1 |
| InChIKey | VTPHHBKQARPOQK-JPZXVFPRSA-N |
| XLogP | 3.01 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|