C15H15BrClN5O — CID 11234878
7-[(6-bromo-4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-4-chloropyrrolo[2,3-d]pyrimidin-2-amine (PubChem CID 11234878) has the molecular formula C15H15BrClN5O and a molecular weight of 396.68 g/mol. Its IUPAC name is 7-[(6-bromo-4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-4-chloropyrrolo[2,3-d]pyrimidin-2-amine.
| Compound Name | 7-[(6-bromo-4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-4-chloropyrrolo[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 11234878 |
| Molecular Formula | C15H15BrClN5O |
| Molecular Weight | 396.68 g/mol |
| Exact Mass | 395.01 |
| IUPAC Name | 7-[(6-bromo-4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-4-chloropyrrolo[2,3-d]pyrimidin-2-amine |
| SMILES | COc1c(C)c(Br)nc(Cn2ccc3c(Cl)nc(N)nc32)c1C |
| InChI | InChI=1S/C15H15BrClN5O/c1-7-10(19-12(16)8(2)11(7)23-3)6-22-5-4-9-13(17)20-15(18)21-14(9)22/h4-5H,6H2,1-3H3,(H2,18,20,21) |
| InChIKey | KMORWASDKZQQJQ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.68 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|