C20H16F3N5O — CID 11234948
N-(1H-indazol-3-yl)-7-(trifluoromethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide (PubChem CID 11234948) has the molecular formula C20H16F3N5O and a molecular weight of 399.38 g/mol. Its IUPAC name is N-(1H-indazol-3-yl)-7-(trifluoromethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide.
| Compound Name | N-(1H-indazol-3-yl)-7-(trifluoromethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide |
|---|---|
| PubChem CID | 11234948 |
| Molecular Formula | C20H16F3N5O |
| Molecular Weight | 399.38 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | N-(1H-indazol-3-yl)-7-(trifluoromethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide |
| SMILES | O=C(Nc1n[nH]c2ccccc12)N1CCc2c([nH]c3cc(C(F)(F)F)ccc23)C1 |
| InChI | InChI=1S/C20H16F3N5O/c21-20(22,23)11-5-6-12-13-7-8-28(10-17(13)24-16(12)9-11)19(29)25-18-14-3-1-2-4-15(14)26-27-18/h1-6,9,24H,7-8,10H2,(H2,25,26,27,29) |
| InChIKey | NTARVHOEKSGYGU-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 76.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.38 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|